C14H23N3O4S — CID 95383461
N-[(2R)-1-(furan-2-yl)propan-2-yl]-4-(methanesulfonamido)piperidine-1-carboxamide (PubChem CID 95383461) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is N-[(2R)-1-(furan-2-yl)propan-2-yl]-4-(methanesulfonamido)piperidine-1-carboxamide.
| Compound Name | N-[(2R)-1-(furan-2-yl)propan-2-yl]-4-(methanesulfonamido)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95383461 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[(2R)-1-(furan-2-yl)propan-2-yl]-4-(methanesulfonamido)piperidine-1-carboxamide |
| SMILES | C[C@H](Cc1ccco1)NC(=O)N1CCC(NS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C14H23N3O4S/c1-11(10-13-4-3-9-21-13)15-14(18)17-7-5-12(6-8-17)16-22(2,19)20/h3-4,9,11-12,16H,5-8,10H2,1-2H3,(H,15,18)/t11-/m1/s1 |
| InChIKey | XLEROZJNYHZBHQ-LLVKDONJSA-N |
| XLogP | 0.93 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |