C15H23N3O3 — CID 97087871
(3R)-3-acetamido-N-[(2S)-1-(furan-2-yl)propan-2-yl]piperidine-1-carboxamide (PubChem CID 97087871) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is (3R)-3-acetamido-N-[(2S)-1-(furan-2-yl)propan-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-acetamido-N-[(2S)-1-(furan-2-yl)propan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97087871 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | (3R)-3-acetamido-N-[(2S)-1-(furan-2-yl)propan-2-yl]piperidine-1-carboxamide |
| SMILES | CC(=O)N[C@@H]1CCCN(C(=O)N[C@@H](C)Cc2ccco2)C1 |
| InChI | InChI=1S/C15H23N3O3/c1-11(9-14-6-4-8-21-14)16-15(20)18-7-3-5-13(10-18)17-12(2)19/h4,6,8,11,13H,3,5,7,9-10H2,1-2H3,(H,16,20)(H,17,19)/t11-,13+/m0/s1 |
| InChIKey | MNZHVKZJDXHVGB-WCQYABFASA-N |
| XLogP | 1.52 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |