C15H22N2O4 — CID 81128264
(3R)-1-[4-(furan-2-yl)butan-2-ylcarbamoyl]piperidine-3-carboxylic acid (PubChem CID 81128264) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is (3R)-1-[4-(furan-2-yl)butan-2-ylcarbamoyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[4-(furan-2-yl)butan-2-ylcarbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 81128264 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (3R)-1-[4-(furan-2-yl)butan-2-ylcarbamoyl]piperidine-3-carboxylic acid |
| SMILES | CC(CCc1ccco1)NC(=O)N1CCC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C15H22N2O4/c1-11(6-7-13-5-3-9-21-13)16-15(20)17-8-2-4-12(10-17)14(18)19/h3,5,9,11-12H,2,4,6-8,10H2,1H3,(H,16,20)(H,18,19)/t11?,12-/m1/s1 |
| InChIKey | LSEQHQHZRHVOPU-PIJUOVFKSA-N |
| XLogP | 2.11 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |