C16H24N2O3 — CID 121084182
N-cycloheptyl-N'-[1-(furan-2-yl)propan-2-yl]oxamide (PubChem CID 121084182) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-cycloheptyl-N'-[1-(furan-2-yl)propan-2-yl]oxamide.
| Compound Name | N-cycloheptyl-N'-[1-(furan-2-yl)propan-2-yl]oxamide |
|---|---|
| PubChem CID | 121084182 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-cycloheptyl-N'-[1-(furan-2-yl)propan-2-yl]oxamide |
| SMILES | CC(Cc1ccco1)NC(=O)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C16H24N2O3/c1-12(11-14-9-6-10-21-14)17-15(19)16(20)18-13-7-4-2-3-5-8-13/h6,9-10,12-13H,2-5,7-8,11H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | HDBBXVLIFXXJKC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|