C16H25N3O4S — CID 3463565
N-(furan-2-ylmethyl)-1-piperidin-1-ylsulfonylpiperidine-4-carboxamide (PubChem CID 3463565) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-piperidin-1-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-piperidin-1-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3463565 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-piperidin-1-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCc1ccco1)C1CCN(S(=O)(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C16H25N3O4S/c20-16(17-13-15-5-4-12-23-15)14-6-10-19(11-7-14)24(21,22)18-8-2-1-3-9-18/h4-5,12,14H,1-3,6-11,13H2,(H,17,20) |
| InChIKey | CJOWZXWQUSZDNX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |