C17H24ClN3O3S — CID 3448161
N-[(2-chlorophenyl)methyl]-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide (PubChem CID 3448161) has the molecular formula C17H24ClN3O3S and a molecular weight of 385.92 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3448161 |
| Molecular Formula | C17H24ClN3O3S |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1Cl)C1CCN(S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C17H24ClN3O3S/c18-16-6-2-1-5-15(16)13-19-17(22)14-7-11-21(12-8-14)25(23,24)20-9-3-4-10-20/h1-2,5-6,14H,3-4,7-13H2,(H,19,22) |
| InChIKey | KODZGOREPPHOBM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |