C13H16ClNOS — CID 110851376
N-[(2-chlorophenyl)methyl]thiane-4-carboxamide (PubChem CID 110851376) has the molecular formula C13H16ClNOS and a molecular weight of 269.80 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]thiane-4-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]thiane-4-carboxamide |
|---|---|
| PubChem CID | 110851376 |
| Molecular Formula | C13H16ClNOS |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]thiane-4-carboxamide |
| SMILES | O=C(NCc1ccccc1Cl)C1CCSCC1 |
| InChI | InChI=1S/C13H16ClNOS/c14-12-4-2-1-3-11(12)9-15-13(16)10-5-7-17-8-6-10/h1-4,10H,5-9H2,(H,15,16) |
| InChIKey | LNCIXWIKTGWQBM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |