C24H30ClN3O3S — CID 99958010
1-[(2-chlorophenyl)methylsulfonyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 99958010) has the molecular formula C24H30ClN3O3S and a molecular weight of 476.04 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methylsulfonyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methylsulfonyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 99958010 |
| Molecular Formula | C24H30ClN3O3S |
| Molecular Weight | 476.04 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 1-[(2-chlorophenyl)methylsulfonyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCCC2)cc1)C1CCN(S(=O)(=O)Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C24H30ClN3O3S/c25-23-6-2-1-5-21(23)18-32(30,31)28-15-11-20(12-16-28)24(29)26-17-19-7-9-22(10-8-19)27-13-3-4-14-27/h1-2,5-10,20H,3-4,11-18H2,(H,26,29) |
| InChIKey | DZHPZNJUXXDQRS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.04 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|