C25H33N3O3S — CID 30392390
1-[(4-methylphenyl)methylsulfonyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 30392390) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methylsulfonyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(4-methylphenyl)methylsulfonyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30392390 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 1-[(4-methylphenyl)methylsulfonyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(CS(=O)(=O)N2CCC(C(=O)NCc3ccc(N4CCCC4)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H33N3O3S/c1-20-4-6-22(7-5-20)19-32(30,31)28-16-12-23(13-17-28)25(29)26-18-21-8-10-24(11-9-21)27-14-2-3-15-27/h4-11,23H,2-3,12-19H2,1H3,(H,26,29) |
| InChIKey | DVVORXPDLLZBQD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|