C15H17N3O5S2 — CID 9477271
N'-(furan-2-carbonyl)-1-thiophen-2-ylsulfonylpiperidine-4-carbohydrazide (PubChem CID 9477271) has the molecular formula C15H17N3O5S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is N'-(furan-2-carbonyl)-1-thiophen-2-ylsulfonylpiperidine-4-carbohydrazide.
| Compound Name | N'-(furan-2-carbonyl)-1-thiophen-2-ylsulfonylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 9477271 |
| Molecular Formula | C15H17N3O5S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | N'-(furan-2-carbonyl)-1-thiophen-2-ylsulfonylpiperidine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(S(=O)(=O)c2cccs2)CC1)c1ccco1 |
| InChI | InChI=1S/C15H17N3O5S2/c19-14(16-17-15(20)12-3-1-9-23-12)11-5-7-18(8-6-11)25(21,22)13-4-2-10-24-13/h1-4,9-11H,5-8H2,(H,16,19)(H,17,20) |
| InChIKey | OKQNULQOUVLUPA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|