C13H14N2O4S2 — CID 756358
furan-2-yl-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 756358) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is furan-2-yl-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | furan-2-yl-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 756358 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | furan-2-yl-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C13H14N2O4S2/c16-13(11-3-1-9-19-11)14-5-7-15(8-6-14)21(17,18)12-4-2-10-20-12/h1-4,9-10H,5-8H2 |
| InChIKey | DZSMVTSUROBTNA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |