C17H18N2O5S2 — CID 9496457
methyl 4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)benzoate (PubChem CID 9496457) has the molecular formula C17H18N2O5S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is methyl 4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)benzoate.
| Compound Name | methyl 4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)benzoate |
|---|---|
| PubChem CID | 9496457 |
| Molecular Formula | C17H18N2O5S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | methyl 4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N2CCN(S(=O)(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C17H18N2O5S2/c1-24-17(21)14-6-4-13(5-7-14)16(20)18-8-10-19(11-9-18)26(22,23)15-3-2-12-25-15/h2-7,12H,8-11H2,1H3 |
| InChIKey | FHKCJAFZEHLYJV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |