C21H23N3O3S2 — CID 4785102
[4-(2,5-dimethylpyrrol-1-yl)phenyl]-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 4785102) has the molecular formula C21H23N3O3S2 and a molecular weight of 429.57 g/mol. Its IUPAC name is [4-(2,5-dimethylpyrrol-1-yl)phenyl]-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [4-(2,5-dimethylpyrrol-1-yl)phenyl]-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 4785102 |
| Molecular Formula | C21H23N3O3S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | [4-(2,5-dimethylpyrrol-1-yl)phenyl]-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)N2CCN(S(=O)(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C21H23N3O3S2/c1-16-5-6-17(2)24(16)19-9-7-18(8-10-19)21(25)22-11-13-23(14-12-22)29(26,27)20-4-3-15-28-20/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | BVJIJAFVFVZMSB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|