C15H16N2O4S2 — CID 38068353
(2-hydroxyphenyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 38068353) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is (2-hydroxyphenyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (2-hydroxyphenyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 38068353 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | (2-hydroxyphenyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccccc1O)N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C15H16N2O4S2/c18-13-5-2-1-4-12(13)15(19)16-7-9-17(10-8-16)23(20,21)14-6-3-11-22-14/h1-6,11,18H,7-10H2 |
| InChIKey | LVVQEOHQFIGVBI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |