C13H15ClN4O3S2 — CID 19279155
(4-chloro-1-methylpyrazol-3-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 19279155) has the molecular formula C13H15ClN4O3S2 and a molecular weight of 374.88 g/mol. Its IUPAC name is (4-chloro-1-methylpyrazol-3-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (4-chloro-1-methylpyrazol-3-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 19279155 |
| Molecular Formula | C13H15ClN4O3S2 |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | (4-chloro-1-methylpyrazol-3-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | Cn1cc(Cl)c(C(=O)N2CCN(S(=O)(=O)c3cccs3)CC2)n1 |
| InChI | InChI=1S/C13H15ClN4O3S2/c1-16-9-10(14)12(15-16)13(19)17-4-6-18(7-5-17)23(20,21)11-3-2-8-22-11/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | KAFXNVIRDZPXIZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |