C14H17ClN4O3S2 — CID 19478969
(4-chloro-1-ethylpyrazol-5-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 19478969) has the molecular formula C14H17ClN4O3S2 and a molecular weight of 388.90 g/mol. Its IUPAC name is (4-chloro-1-ethylpyrazol-5-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (4-chloro-1-ethylpyrazol-5-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 19478969 |
| Molecular Formula | C14H17ClN4O3S2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | (4-chloro-1-ethylpyrazol-5-yl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | CCn1ncc(Cl)c1C(=O)N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C14H17ClN4O3S2/c1-2-19-13(11(15)10-16-19)14(20)17-5-7-18(8-6-17)24(21,22)12-4-3-9-23-12/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | JTQDWTSXPWTMBT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |