C15H17N3O3S2 — CID 18148460
(6-methyl-3-pyridinyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone (PubChem CID 18148460) has the molecular formula C15H17N3O3S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (6-methyl-3-pyridinyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (6-methyl-3-pyridinyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 18148460 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (6-methyl-3-pyridinyl)-(4-thiophen-2-ylsulfonylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(S(=O)(=O)c3cccs3)CC2)cn1 |
| InChI | InChI=1S/C15H17N3O3S2/c1-12-4-5-13(11-16-12)15(19)17-6-8-18(9-7-17)23(20,21)14-3-2-10-22-14/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | RNRFSRZBCGWAQD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |