C14H16N4O3S2 — CID 110810480
pyrazin-2-yl-(4-thiophen-2-ylsulfonyl-1,4-diazepan-1-yl)methanone (PubChem CID 110810480) has the molecular formula C14H16N4O3S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is pyrazin-2-yl-(4-thiophen-2-ylsulfonyl-1,4-diazepan-1-yl)methanone.
| Compound Name | pyrazin-2-yl-(4-thiophen-2-ylsulfonyl-1,4-diazepan-1-yl)methanone |
|---|---|
| PubChem CID | 110810480 |
| Molecular Formula | C14H16N4O3S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | pyrazin-2-yl-(4-thiophen-2-ylsulfonyl-1,4-diazepan-1-yl)methanone |
| SMILES | O=C(c1cnccn1)N1CCCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C14H16N4O3S2/c19-14(12-11-15-4-5-16-12)17-6-2-7-18(9-8-17)23(20,21)13-3-1-10-22-13/h1,3-5,10-11H,2,6-9H2 |
| InChIKey | BRCOVRAQABJRCL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |