C15H16N4O3S — CID 27509869
[4-(benzenesulfonyl)piperazin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 27509869) has the molecular formula C15H16N4O3S and a molecular weight of 332.38 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperazin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [4-(benzenesulfonyl)piperazin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 27509869 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [4-(benzenesulfonyl)piperazin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H16N4O3S/c20-15(14-12-16-6-7-17-14)18-8-10-19(11-9-18)23(21,22)13-4-2-1-3-5-13/h1-7,12H,8-11H2 |
| InChIKey | MGPQFILLJVOKQA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |