C15H14Cl2N4O3S — CID 27563231
[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 27563231) has the molecular formula C15H14Cl2N4O3S and a molecular weight of 401.28 g/mol. Its IUPAC name is [4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 27563231 |
| Molecular Formula | C15H14Cl2N4O3S |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | [4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C15H14Cl2N4O3S/c16-11-2-1-3-13(14(11)17)25(23,24)21-8-6-20(7-9-21)15(22)12-10-18-4-5-19-12/h1-5,10H,6-9H2 |
| InChIKey | KHBRKSWDVPAGAM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |