C16H19N3O5S3 — CID 42087714
N-[4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)phenyl]methanesulfonamide (PubChem CID 42087714) has the molecular formula C16H19N3O5S3 and a molecular weight of 429.55 g/mol. Its IUPAC name is N-[4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)phenyl]methanesulfonamide.
| Compound Name | N-[4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 42087714 |
| Molecular Formula | C16H19N3O5S3 |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | N-[4-(4-thiophen-2-ylsulfonylpiperazine-1-carbonyl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)N2CCN(S(=O)(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C16H19N3O5S3/c1-26(21,22)17-14-6-4-13(5-7-14)16(20)18-8-10-19(11-9-18)27(23,24)15-3-2-12-25-15/h2-7,12,17H,8-11H2,1H3 |
| InChIKey | FROOUWSYOXJERP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |