C23H23N3O5S3 — CID 6187731
N-[4-[4-[(E)-2-phenylethenyl]sulfonylpiperazine-1-carbonyl]phenyl]thiophene-2-sulfonamide (PubChem CID 6187731) has the molecular formula C23H23N3O5S3 and a molecular weight of 517.65 g/mol. Its IUPAC name is N-[4-[4-[(E)-2-phenylethenyl]sulfonylpiperazine-1-carbonyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-[4-[(E)-2-phenylethenyl]sulfonylpiperazine-1-carbonyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 6187731 |
| Molecular Formula | C23H23N3O5S3 |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | N-[4-[4-[(E)-2-phenylethenyl]sulfonylpiperazine-1-carbonyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=C(c1ccc(NS(=O)(=O)c2cccs2)cc1)N1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C23H23N3O5S3/c27-23(20-8-10-21(11-9-20)24-34(30,31)22-7-4-17-32-22)25-13-15-26(16-14-25)33(28,29)18-12-19-5-2-1-3-6-19/h1-12,17-18,24H,13-16H2/b18-12+ |
| InChIKey | SGJWMJCTHJGMKR-LDADJPATSA-N |
| XLogP | 3.31 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |