C19H19ClN2O3S — CID 8925154
(3-chlorophenyl)-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methanone (PubChem CID 8925154) has the molecular formula C19H19ClN2O3S and a molecular weight of 390.89 g/mol. Its IUPAC name is (3-chlorophenyl)-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3-chlorophenyl)-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 8925154 |
| Molecular Formula | C19H19ClN2O3S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (3-chlorophenyl)-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(Cl)c1)N1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C19H19ClN2O3S/c20-18-8-4-7-17(15-18)19(23)21-10-12-22(13-11-21)26(24,25)14-9-16-5-2-1-3-6-16/h1-9,14-15H,10-13H2/b14-9+ |
| InChIKey | KYMSQCNSWFYPCA-NTEUORMPSA-N |
| XLogP | 3.10 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |