C19H19BrN2O3S — CID 26870461
(2-bromophenyl)-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methanone (PubChem CID 26870461) has the molecular formula C19H19BrN2O3S and a molecular weight of 435.34 g/mol. Its IUPAC name is (2-bromophenyl)-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methanone.
| Compound Name | (2-bromophenyl)-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26870461 |
| Molecular Formula | C19H19BrN2O3S |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | (2-bromophenyl)-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1ccccc1Br)N1CCN(S(=O)(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C19H19BrN2O3S/c20-18-9-5-4-8-17(18)19(23)21-11-13-22(14-12-21)26(24,25)15-10-16-6-2-1-3-7-16/h1-10,15H,11-14H2/b15-10+ |
| InChIKey | MAJACSUJGONWFN-XNTDXEJSSA-N |
| XLogP | 3.21 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |