C20H21ClN2O3S2 — CID 74285453
2-(4-chlorophenyl)sulfanyl-1-[4-(2-phenylethenylsulfonyl)piperazin-1-yl]ethanone (PubChem CID 74285453) has the molecular formula C20H21ClN2O3S2 and a molecular weight of 436.99 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-1-[4-(2-phenylethenylsulfonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-1-[4-(2-phenylethenylsulfonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 74285453 |
| Molecular Formula | C20H21ClN2O3S2 |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-1-[4-(2-phenylethenylsulfonyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CSc1ccc(Cl)cc1)N1CCN(S(=O)(=O)C=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H21ClN2O3S2/c21-18-6-8-19(9-7-18)27-16-20(24)22-11-13-23(14-12-22)28(25,26)15-10-17-4-2-1-3-5-17/h1-10,15H,11-14,16H2 |
| InChIKey | HLOHLIYSAJEZPA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |