C18H18ClFN2O3S2 — CID 18164606
2-(4-chlorophenyl)sulfanyl-1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 18164606) has the molecular formula C18H18ClFN2O3S2 and a molecular weight of 428.94 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 18164606 |
| Molecular Formula | C18H18ClFN2O3S2 |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | O=C(CSc1ccc(Cl)cc1)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H18ClFN2O3S2/c19-14-4-6-16(7-5-14)26-13-18(23)21-8-10-22(11-9-21)27(24,25)17-3-1-2-15(20)12-17/h1-7,12H,8-11,13H2 |
| InChIKey | RDOPPPYVZAXBFR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |