C17H17ClFN3O3S — CID 27868228
N-(4-chlorophenyl)-4-(3-fluorophenyl)sulfonylpiperazine-1-carboxamide (PubChem CID 27868228) has the molecular formula C17H17ClFN3O3S and a molecular weight of 397.86 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-(3-fluorophenyl)sulfonylpiperazine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-(3-fluorophenyl)sulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 27868228 |
| Molecular Formula | C17H17ClFN3O3S |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-(4-chlorophenyl)-4-(3-fluorophenyl)sulfonylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H17ClFN3O3S/c18-13-4-6-15(7-5-13)20-17(23)21-8-10-22(11-9-21)26(24,25)16-3-1-2-14(19)12-16/h1-7,12H,8-11H2,(H,20,23) |
| InChIKey | PMQXKHLRFZAZPW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |