C11H15FN4O3S — CID 61131305
N-(3-fluorophenyl)-4-sulfamoylpiperazine-1-carboxamide (PubChem CID 61131305) has the molecular formula C11H15FN4O3S and a molecular weight of 302.33 g/mol. Its IUPAC name is N-(3-fluorophenyl)-4-sulfamoylpiperazine-1-carboxamide.
| Compound Name | N-(3-fluorophenyl)-4-sulfamoylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 61131305 |
| Molecular Formula | C11H15FN4O3S |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-(3-fluorophenyl)-4-sulfamoylpiperazine-1-carboxamide |
| SMILES | NS(=O)(=O)N1CCN(C(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C11H15FN4O3S/c12-9-2-1-3-10(8-9)14-11(17)15-4-6-16(7-5-15)20(13,18)19/h1-3,8H,4-7H2,(H,14,17)(H2,13,18,19) |
| InChIKey | MNNZIMNNTCOFGF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |