C13H19FN3O+ — CID 68939615
N-(3-fluorophenyl)-4,4-dimethylpiperazin-4-ium-1-carboxamide (PubChem CID 68939615) has the molecular formula C13H19FN3O+ and a molecular weight of 252.31 g/mol. Its IUPAC name is N-(3-fluorophenyl)-4,4-dimethylpiperazin-4-ium-1-carboxamide.
| Compound Name | N-(3-fluorophenyl)-4,4-dimethylpiperazin-4-ium-1-carboxamide |
|---|---|
| PubChem CID | 68939615 |
| Molecular Formula | C13H19FN3O+ |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | N-(3-fluorophenyl)-4,4-dimethylpiperazin-4-ium-1-carboxamide |
| SMILES | C[N+]1(C)CCN(C(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C13H18FN3O/c1-17(2)8-6-16(7-9-17)13(18)15-12-5-3-4-11(14)10-12/h3-5,10H,6-9H2,1-2H3/p+1 |
| InChIKey | BITFFWCLWQNVOG-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|