C11H13FN2O — CID 6469622
N-(3-fluorophenyl)pyrrolidine-1-carboxamide (PubChem CID 6469622) has the molecular formula C11H13FN2O and a molecular weight of 208.24 g/mol. Its IUPAC name is N-(3-fluorophenyl)pyrrolidine-1-carboxamide.
| Compound Name | N-(3-fluorophenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 6469622 |
| Molecular Formula | C11H13FN2O |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-(3-fluorophenyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)N1CCCC1 |
| InChI | InChI=1S/C11H13FN2O/c12-9-4-3-5-10(8-9)13-11(15)14-6-1-2-7-14/h3-5,8H,1-2,6-7H2,(H,13,15) |
| InChIKey | KXULJPFESFYYLO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |