C13H16FN3O2 — CID 108893994
1-N-(3-fluorophenyl)piperidine-1,4-dicarboxamide (PubChem CID 108893994) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is 1-N-(3-fluorophenyl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-(3-fluorophenyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 108893994 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-N-(3-fluorophenyl)piperidine-1,4-dicarboxamide |
| SMILES | NC(=O)C1CCN(C(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C13H16FN3O2/c14-10-2-1-3-11(8-10)16-13(19)17-6-4-9(5-7-17)12(15)18/h1-3,8-9H,4-7H2,(H2,15,18)(H,16,19) |
| InChIKey | FPUNHTJYSDBFBD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |