C14H18FN3O2 — CID 97221670
(3S,6S)-1-N-(3-fluorophenyl)-6-methylpiperidine-1,3-dicarboxamide (PubChem CID 97221670) has the molecular formula C14H18FN3O2 and a molecular weight of 279.31 g/mol. Its IUPAC name is (3S,6S)-1-N-(3-fluorophenyl)-6-methylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S,6S)-1-N-(3-fluorophenyl)-6-methylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 97221670 |
| Molecular Formula | C14H18FN3O2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (3S,6S)-1-N-(3-fluorophenyl)-6-methylpiperidine-1,3-dicarboxamide |
| SMILES | C[C@H]1CC[C@H](C(N)=O)CN1C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C14H18FN3O2/c1-9-5-6-10(13(16)19)8-18(9)14(20)17-12-4-2-3-11(15)7-12/h2-4,7,9-10H,5-6,8H2,1H3,(H2,16,19)(H,17,20)/t9-,10-/m0/s1 |
| InChIKey | CTGBQYYVWLXDNC-UWVGGRQHSA-N |
| XLogP | 1.94 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |