C15H20FN3O — CID 127769677
N-(3-fluorophenyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxamide (PubChem CID 127769677) has the molecular formula C15H20FN3O and a molecular weight of 277.34 g/mol. Its IUPAC name is N-(3-fluorophenyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxamide.
| Compound Name | N-(3-fluorophenyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 127769677 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N-(3-fluorophenyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxamide |
| SMILES | CN1CCC2CCN(C(=O)Nc3cccc(F)c3)C2C1 |
| InChI | InChI=1S/C15H20FN3O/c1-18-7-5-11-6-8-19(14(11)10-18)15(20)17-13-4-2-3-12(16)9-13/h2-4,9,11,14H,5-8,10H2,1H3,(H,17,20) |
| InChIKey | CRZLZEPOHXQZEF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |