C19H22N4O2 — CID 75444865
6-methyl-1-N-(2-pyridin-4-ylphenyl)piperidine-1,3-dicarboxamide (PubChem CID 75444865) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 6-methyl-1-N-(2-pyridin-4-ylphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | 6-methyl-1-N-(2-pyridin-4-ylphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 75444865 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 6-methyl-1-N-(2-pyridin-4-ylphenyl)piperidine-1,3-dicarboxamide |
| SMILES | CC1CCC(C(N)=O)CN1C(=O)Nc1ccccc1-c1ccncc1 |
| InChI | InChI=1S/C19H22N4O2/c1-13-6-7-15(18(20)24)12-23(13)19(25)22-17-5-3-2-4-16(17)14-8-10-21-11-9-14/h2-5,8-11,13,15H,6-7,12H2,1H3,(H2,20,24)(H,22,25) |
| InChIKey | LVSDNUYPLWYZNL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |