C22H24FN3O3 — CID 109151103
1-N-(4-acetamidophenyl)-4-N-(3-fluorophenyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109151103) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is 1-N-(4-acetamidophenyl)-4-N-(3-fluorophenyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N-(4-acetamidophenyl)-4-N-(3-fluorophenyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109151103 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 1-N-(4-acetamidophenyl)-4-N-(3-fluorophenyl)cyclohexane-1,4-dicarboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C2CCC(C(=O)Nc3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C22H24FN3O3/c1-14(27)24-18-9-11-19(12-10-18)25-21(28)15-5-7-16(8-6-15)22(29)26-20-4-2-3-17(23)13-20/h2-4,9-13,15-16H,5-8H2,1H3,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | WTSZUFYMCJQTDI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |