C17H21FN2O2 — CID 109145001
4-N-(3-fluorophenyl)-1-N-prop-2-enylcyclohexane-1,4-dicarboxamide (PubChem CID 109145001) has the molecular formula C17H21FN2O2 and a molecular weight of 304.37 g/mol. Its IUPAC name is 4-N-(3-fluorophenyl)-1-N-prop-2-enylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(3-fluorophenyl)-1-N-prop-2-enylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109145001 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-N-(3-fluorophenyl)-1-N-prop-2-enylcyclohexane-1,4-dicarboxamide |
| SMILES | C=CCNC(=O)C1CCC(C(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H21FN2O2/c1-2-10-19-16(21)12-6-8-13(9-7-12)17(22)20-15-5-3-4-14(18)11-15/h2-5,11-13H,1,6-10H2,(H,19,21)(H,20,22) |
| InChIKey | MJYZLWFGDZZNDN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|