C14H17FN2O2 — CID 772128
N-[2-(3-fluoroanilino)-2-oxoethyl]cyclopentanecarboxamide (PubChem CID 772128) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is N-[2-(3-fluoroanilino)-2-oxoethyl]cyclopentanecarboxamide.
| Compound Name | N-[2-(3-fluoroanilino)-2-oxoethyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 772128 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N-[2-(3-fluoroanilino)-2-oxoethyl]cyclopentanecarboxamide |
| SMILES | O=C(CNC(=O)C1CCCC1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C14H17FN2O2/c15-11-6-3-7-12(8-11)17-13(18)9-16-14(19)10-4-1-2-5-10/h3,6-8,10H,1-2,4-5,9H2,(H,16,19)(H,17,18) |
| InChIKey | VIZQZSMAMATSNQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |