C21H29FN4O3 — CID 9020209
N-[2-[4-[2-(3-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-2-oxoethyl]cyclohexanecarboxamide (PubChem CID 9020209) has the molecular formula C21H29FN4O3 and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[2-[4-[2-(3-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-2-oxoethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[4-[2-(3-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-2-oxoethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 9020209 |
| Molecular Formula | C21H29FN4O3 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-[2-[4-[2-(3-fluoroanilino)-2-oxoethyl]piperazin-1-yl]-2-oxoethyl]cyclohexanecarboxamide |
| SMILES | O=C(CN1CCN(C(=O)CNC(=O)C2CCCCC2)CC1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C21H29FN4O3/c22-17-7-4-8-18(13-17)24-19(27)15-25-9-11-26(12-10-25)20(28)14-23-21(29)16-5-2-1-3-6-16/h4,7-8,13,16H,1-3,5-6,9-12,14-15H2,(H,23,29)(H,24,27) |
| InChIKey | CRMAIZRZFRWZTC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |