C15H20FN3O3 — CID 2654273
ethyl 4-[2-(3-fluoroanilino)-2-oxoethyl]piperazine-1-carboxylate (PubChem CID 2654273) has the molecular formula C15H20FN3O3 and a molecular weight of 309.34 g/mol. Its IUPAC name is ethyl 4-[2-(3-fluoroanilino)-2-oxoethyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(3-fluoroanilino)-2-oxoethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 2654273 |
| Molecular Formula | C15H20FN3O3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | ethyl 4-[2-(3-fluoroanilino)-2-oxoethyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C15H20FN3O3/c1-2-22-15(21)19-8-6-18(7-9-19)11-14(20)17-13-5-3-4-12(16)10-13/h3-5,10H,2,6-9,11H2,1H3,(H,17,20) |
| InChIKey | BFYGZMKTIKJLCO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |