C20H23FN4OS — CID 9214347
N-(3-fluorophenyl)-2-[4-[(2-methylphenyl)carbamothioyl]piperazin-1-yl]acetamide (PubChem CID 9214347) has the molecular formula C20H23FN4OS and a molecular weight of 386.50 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[4-[(2-methylphenyl)carbamothioyl]piperazin-1-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[4-[(2-methylphenyl)carbamothioyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9214347 |
| Molecular Formula | C20H23FN4OS |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-(3-fluorophenyl)-2-[4-[(2-methylphenyl)carbamothioyl]piperazin-1-yl]acetamide |
| SMILES | Cc1ccccc1NC(=S)N1CCN(CC(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C20H23FN4OS/c1-15-5-2-3-8-18(15)23-20(27)25-11-9-24(10-12-25)14-19(26)22-17-7-4-6-16(21)13-17/h2-8,13H,9-12,14H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | OJYVFHZJVUUFQY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|