C20H24N4S2 — CID 8624605
1-N,4-N-bis(2-methylphenyl)piperazine-1,4-dicarbothioamide (PubChem CID 8624605) has the molecular formula C20H24N4S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 1-N,4-N-bis(2-methylphenyl)piperazine-1,4-dicarbothioamide.
| Compound Name | 1-N,4-N-bis(2-methylphenyl)piperazine-1,4-dicarbothioamide |
|---|---|
| PubChem CID | 8624605 |
| Molecular Formula | C20H24N4S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-N,4-N-bis(2-methylphenyl)piperazine-1,4-dicarbothioamide |
| SMILES | Cc1ccccc1NC(=S)N1CCN(C(=S)Nc2ccccc2C)CC1 |
| InChI | InChI=1S/C20H24N4S2/c1-15-7-3-5-9-17(15)21-19(25)23-11-13-24(14-12-23)20(26)22-18-10-6-4-8-16(18)2/h3-10H,11-14H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | QQQIRDSFXDFXMZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|