C17H25N3S2 — CID 100569091
N-(2-methylphenyl)-4-(thian-4-yl)piperazine-1-carbothioamide (PubChem CID 100569091) has the molecular formula C17H25N3S2 and a molecular weight of 335.54 g/mol. Its IUPAC name is N-(2-methylphenyl)-4-(thian-4-yl)piperazine-1-carbothioamide.
| Compound Name | N-(2-methylphenyl)-4-(thian-4-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 100569091 |
| Molecular Formula | C17H25N3S2 |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-(2-methylphenyl)-4-(thian-4-yl)piperazine-1-carbothioamide |
| SMILES | Cc1ccccc1NC(=S)N1CCN(C2CCSCC2)CC1 |
| InChI | InChI=1S/C17H25N3S2/c1-14-4-2-3-5-16(14)18-17(21)20-10-8-19(9-11-20)15-6-12-22-13-7-15/h2-5,15H,6-13H2,1H3,(H,18,21) |
| InChIKey | PMCNCSNWYGPXSK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|