C20H29N3O2S — CID 5172979
methyl 2-[(4-cycloheptylpiperazine-1-carbothioyl)amino]benzoate (PubChem CID 5172979) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is methyl 2-[(4-cycloheptylpiperazine-1-carbothioyl)amino]benzoate.
| Compound Name | methyl 2-[(4-cycloheptylpiperazine-1-carbothioyl)amino]benzoate |
|---|---|
| PubChem CID | 5172979 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | methyl 2-[(4-cycloheptylpiperazine-1-carbothioyl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)N1CCN(C2CCCCCC2)CC1 |
| InChI | InChI=1S/C20H29N3O2S/c1-25-19(24)17-10-6-7-11-18(17)21-20(26)23-14-12-22(13-15-23)16-8-4-2-3-5-9-16/h6-7,10-11,16H,2-5,8-9,12-15H2,1H3,(H,21,26) |
| InChIKey | UALFLVBSTHZUDQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|