C19H27N3O3 — CID 11837383
methyl 2-[[2-(4-pyrrolidin-1-ylpiperidin-1-yl)acetyl]amino]benzoate (PubChem CID 11837383) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is methyl 2-[[2-(4-pyrrolidin-1-ylpiperidin-1-yl)acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(4-pyrrolidin-1-ylpiperidin-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 11837383 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | methyl 2-[[2-(4-pyrrolidin-1-ylpiperidin-1-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CN1CCC(N2CCCC2)CC1 |
| InChI | InChI=1S/C19H27N3O3/c1-25-19(24)16-6-2-3-7-17(16)20-18(23)14-21-12-8-15(9-13-21)22-10-4-5-11-22/h2-3,6-7,15H,4-5,8-14H2,1H3,(H,20,23) |
| InChIKey | UYAIRMFUGPKMPK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |