C21H28F3N3O5 — CID 171668861
oxalic acid;2-(4-piperidin-1-ylpiperidin-1-yl)-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 171668861) has the molecular formula C21H28F3N3O5 and a molecular weight of 459.47 g/mol. Its IUPAC name is oxalic acid;2-(4-piperidin-1-ylpiperidin-1-yl)-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | oxalic acid;2-(4-piperidin-1-ylpiperidin-1-yl)-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 171668861 |
| Molecular Formula | C21H28F3N3O5 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | oxalic acid;2-(4-piperidin-1-ylpiperidin-1-yl)-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCC(N2CCCCC2)CC1)Nc1ccccc1C(F)(F)F.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H26F3N3O.C2H2O4/c20-19(21,22)16-6-2-3-7-17(16)23-18(26)14-24-12-8-15(9-13-24)25-10-4-1-5-11-25;3-1(4)2(5)6/h2-3,6-7,15H,1,4-5,8-14H2,(H,23,26);(H,3,4)(H,5,6) |
| InChIKey | GAAFJJXGQXMKOB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|