C23H26F3N3O2 — CID 55738569
N-[1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]piperidin-4-yl]-3-phenylpropanamide (PubChem CID 55738569) has the molecular formula C23H26F3N3O2 and a molecular weight of 433.47 g/mol. Its IUPAC name is N-[1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]piperidin-4-yl]-3-phenylpropanamide.
| Compound Name | N-[1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]piperidin-4-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 55738569 |
| Molecular Formula | C23H26F3N3O2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-[1-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]piperidin-4-yl]-3-phenylpropanamide |
| SMILES | O=C(CN1CCC(NC(=O)CCc2ccccc2)CC1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H26F3N3O2/c24-23(25,26)19-8-4-5-9-20(19)28-22(31)16-29-14-12-18(13-15-29)27-21(30)11-10-17-6-2-1-3-7-17/h1-9,18H,10-16H2,(H,27,30)(H,28,31) |
| InChIKey | GLCUWSPIWKLAPD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |