C24H31N3O4 — CID 55853187
N-[1-[2-(3,5-dimethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-phenylpropanamide (PubChem CID 55853187) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[1-[2-(3,5-dimethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-phenylpropanamide.
| Compound Name | N-[1-[2-(3,5-dimethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 55853187 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | N-[1-[2-(3,5-dimethoxyanilino)-2-oxoethyl]piperidin-4-yl]-3-phenylpropanamide |
| SMILES | COc1cc(NC(=O)CN2CCC(NC(=O)CCc3ccccc3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C24H31N3O4/c1-30-21-14-20(15-22(16-21)31-2)26-24(29)17-27-12-10-19(11-13-27)25-23(28)9-8-18-6-4-3-5-7-18/h3-7,14-16,19H,8-13,17H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | BPDKPHXLYCAVSC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |