C25H31N3O4 — CID 55524217
2-[4-[[2-[4-(3-oxobutyl)phenoxy]acetyl]amino]piperidin-1-yl]-N-phenylacetamide (PubChem CID 55524217) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-[4-[[2-[4-(3-oxobutyl)phenoxy]acetyl]amino]piperidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-[[2-[4-(3-oxobutyl)phenoxy]acetyl]amino]piperidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 55524217 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2-[4-[[2-[4-(3-oxobutyl)phenoxy]acetyl]amino]piperidin-1-yl]-N-phenylacetamide |
| SMILES | CC(=O)CCc1ccc(OCC(=O)NC2CCN(CC(=O)Nc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H31N3O4/c1-19(29)7-8-20-9-11-23(12-10-20)32-18-25(31)27-22-13-15-28(16-14-22)17-24(30)26-21-5-3-2-4-6-21/h2-6,9-12,22H,7-8,13-18H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | SFEORWKPMGBWCL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |