C23H29N3O2S — CID 43076689
N-[1-[(4-ethoxyphenyl)carbamothioyl]piperidin-4-yl]-3-phenylpropanamide (PubChem CID 43076689) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is N-[1-[(4-ethoxyphenyl)carbamothioyl]piperidin-4-yl]-3-phenylpropanamide.
| Compound Name | N-[1-[(4-ethoxyphenyl)carbamothioyl]piperidin-4-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 43076689 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N-[1-[(4-ethoxyphenyl)carbamothioyl]piperidin-4-yl]-3-phenylpropanamide |
| SMILES | CCOc1ccc(NC(=S)N2CCC(NC(=O)CCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O2S/c1-2-28-21-11-9-19(10-12-21)25-23(29)26-16-14-20(15-17-26)24-22(27)13-8-18-6-4-3-5-7-18/h3-7,9-12,20H,2,8,13-17H2,1H3,(H,24,27)(H,25,29) |
| InChIKey | GMINWMCPKKZAOU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|