C21H24N4O3S — CID 43076661
N-[1-[(4-nitrophenyl)carbamothioyl]piperidin-4-yl]-3-phenylpropanamide (PubChem CID 43076661) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is N-[1-[(4-nitrophenyl)carbamothioyl]piperidin-4-yl]-3-phenylpropanamide.
| Compound Name | N-[1-[(4-nitrophenyl)carbamothioyl]piperidin-4-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 43076661 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-[1-[(4-nitrophenyl)carbamothioyl]piperidin-4-yl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NC1CCN(C(=S)Nc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C21H24N4O3S/c26-20(11-6-16-4-2-1-3-5-16)22-18-12-14-24(15-13-18)21(29)23-17-7-9-19(10-8-17)25(27)28/h1-5,7-10,18H,6,11-15H2,(H,22,26)(H,23,29) |
| InChIKey | IQAZEVOQHHUBAF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|